About N-(dimethylcarbamoyl)-N,4-dimethylpiperazine-1-carboxamide;hydrochloride
N-(dimethylcarbamoyl)-N,4-dimethylpiperazine-1-carboxamide;hydrochloride (PubChem CID 3066977) has the molecular formula C10H21ClN4O2
and a molecular weight of 264.76 g/mol. Its IUPAC name is N-(dimethylcarbamoyl)-N,4-dimethylpiperazine-1-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | N-(dimethylcarbamoyl)-N,4-dimethylpiperazine-1-carboxamide;hydrochloride |
| PubChem CID | 3066977 |
| Molecular Formula | C10H21ClN4O2 |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | N-(dimethylcarbamoyl)-N,4-dimethylpiperazine-1-carboxamide;hydrochloride |
| SMILES | CN1CCN(C(=O)N(C)C(=O)N(C)C)CC1.Cl |
| InChI | InChI=1S/C10H20N4O2.ClH/c1-11(2)9(15)13(4)10(16)14-7-5-12(3)6-8-14;/h5-8H2,1-4H3;1H |
| InChIKey | WANUQLSWJLXBAD-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(dimethylcarbamoyl)-N,4-dimethylpiperazine-1-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(dimethylcarbamoyl)-N,4-dimethylpiperazine-1-carboxamide;hydrochloride?
The IUPAC name of N-(dimethylcarbamoyl)-N,4-dimethylpiperazine-1-carboxamide;hydrochloride (CID 3066977) is N-(dimethylcarbamoyl)-N,4-dimethylpiperazine-1-carboxamide;hydrochloride.
What is the SMILES notation for N-(dimethylcarbamoyl)-N,4-dimethylpiperazine-1-carboxamide;hydrochloride?
The canonical SMILES for N-(dimethylcarbamoyl)-N,4-dimethylpiperazine-1-carboxamide;hydrochloride is CN1CCN(C(=O)N(C)C(=O)N(C)C)CC1.Cl.
What is the InChIKey of N-(dimethylcarbamoyl)-N,4-dimethylpiperazine-1-carboxamide;hydrochloride?
The InChIKey is WANUQLSWJLXBAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N4O2.ClH/c1-11(2)9(15)13(4)10(16)14-7-5-12(3)6-8-14;/h5-8H2,1-4H3;1H.
What are the key properties of N-(dimethylcarbamoyl)-N,4-dimethylpiperazine-1-carboxamide;hydrochloride?
N-(dimethylcarbamoyl)-N,4-dimethylpiperazine-1-carboxamide;hydrochloride has a molecular weight of 264.76 g/mol, XLogP of 0.39, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(dimethylcarbamoyl)-N,4-dimethylpiperazine-1-carboxamide;hydrochloride is sourced from PubChem (CID 3066977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).