About 3-anilino-N-methyl-5-(methylamino)-1,2,4-triazine-6-carboxamide
3-anilino-N-methyl-5-(methylamino)-1,2,4-triazine-6-carboxamide (PubChem CID 3067016) has the molecular formula C12H14N6O
and a molecular weight of 258.29 g/mol. Its IUPAC name is 3-anilino-N-methyl-5-(methylamino)-1,2,4-triazine-6-carboxamide.
Molecular Properties
| Compound Name | 3-anilino-N-methyl-5-(methylamino)-1,2,4-triazine-6-carboxamide |
| PubChem CID | 3067016 |
| Molecular Formula | C12H14N6O |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 3-anilino-N-methyl-5-(methylamino)-1,2,4-triazine-6-carboxamide |
| SMILES | CNC(=O)c1nnc(Nc2ccccc2)nc1NC |
| InChI | InChI=1S/C12H14N6O/c1-13-10-9(11(19)14-2)17-18-12(16-10)15-8-6-4-3-5-7-8/h3-7H,1-2H3,(H,14,19)(H2,13,15,16,18) |
| InChIKey | FJAQXDGWNUDZGG-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-anilino-N-methyl-5-(methylamino)-1,2,4-triazine-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-anilino-N-methyl-5-(methylamino)-1,2,4-triazine-6-carboxamide?
The IUPAC name of 3-anilino-N-methyl-5-(methylamino)-1,2,4-triazine-6-carboxamide (CID 3067016) is 3-anilino-N-methyl-5-(methylamino)-1,2,4-triazine-6-carboxamide.
What is the SMILES notation for 3-anilino-N-methyl-5-(methylamino)-1,2,4-triazine-6-carboxamide?
The canonical SMILES for 3-anilino-N-methyl-5-(methylamino)-1,2,4-triazine-6-carboxamide is CNC(=O)c1nnc(Nc2ccccc2)nc1NC.
What is the InChIKey of 3-anilino-N-methyl-5-(methylamino)-1,2,4-triazine-6-carboxamide?
The InChIKey is FJAQXDGWNUDZGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N6O/c1-13-10-9(11(19)14-2)17-18-12(16-10)15-8-6-4-3-5-7-8/h3-7H,1-2H3,(H,14,19)(H2,13,15,16,18).
What are the key properties of 3-anilino-N-methyl-5-(methylamino)-1,2,4-triazine-6-carboxamide?
3-anilino-N-methyl-5-(methylamino)-1,2,4-triazine-6-carboxamide has a molecular weight of 258.29 g/mol, XLogP of 1.02, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-anilino-N-methyl-5-(methylamino)-1,2,4-triazine-6-carboxamide is sourced from PubChem (CID 3067016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).