About (2-oxo-3H-1,3-benzoxazol-6-yl)urea
(2-oxo-3H-1,3-benzoxazol-6-yl)urea (PubChem CID 3067288) has the molecular formula C8H7N3O3
and a molecular weight of 193.16 g/mol. Its IUPAC name is (2-oxo-3H-1,3-benzoxazol-6-yl)urea.
Molecular Properties
| Compound Name | (2-oxo-3H-1,3-benzoxazol-6-yl)urea |
| PubChem CID | 3067288 |
| Molecular Formula | C8H7N3O3 |
| Molecular Weight | 193.16 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | (2-oxo-3H-1,3-benzoxazol-6-yl)urea |
| SMILES | NC(=O)Nc1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C8H7N3O3/c9-7(12)10-4-1-2-5-6(3-4)14-8(13)11-5/h1-3H,(H,11,13)(H3,9,10,12) |
| InChIKey | ZBOYCVVPACPLDZ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 101.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.16 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-oxo-3H-1,3-benzoxazol-6-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxo-3H-1,3-benzoxazol-6-yl)urea?
The IUPAC name of (2-oxo-3H-1,3-benzoxazol-6-yl)urea (CID 3067288) is (2-oxo-3H-1,3-benzoxazol-6-yl)urea.
What is the SMILES notation for (2-oxo-3H-1,3-benzoxazol-6-yl)urea?
The canonical SMILES for (2-oxo-3H-1,3-benzoxazol-6-yl)urea is NC(=O)Nc1ccc2[nH]c(=O)oc2c1.
What is the InChIKey of (2-oxo-3H-1,3-benzoxazol-6-yl)urea?
The InChIKey is ZBOYCVVPACPLDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O3/c9-7(12)10-4-1-2-5-6(3-4)14-8(13)11-5/h1-3H,(H,11,13)(H3,9,10,12).
What are the key properties of (2-oxo-3H-1,3-benzoxazol-6-yl)urea?
(2-oxo-3H-1,3-benzoxazol-6-yl)urea has a molecular weight of 193.16 g/mol, XLogP of 0.61, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxo-3H-1,3-benzoxazol-6-yl)urea is sourced from PubChem (CID 3067288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).