C14H29Cl2N4O4P — CID 3067549
1-[[2-[bis(2-chloroethyl)amino]-2-oxo-1,3,2lambda5-oxazaphosphinan-4-yl]oxy]-1,3,3-triethylurea (PubChem CID 3067549) has the molecular formula C14H29Cl2N4O4P and a molecular weight of 419.29 g/mol. Its IUPAC name is 1-[[2-[bis(2-chloroethyl)amino]-2-oxo-1,3,2lambda5-oxazaphosphinan-4-yl]oxy]-1,3,3-triethylurea.
| Compound Name | 1-[[2-[bis(2-chloroethyl)amino]-2-oxo-1,3,2lambda5-oxazaphosphinan-4-yl]oxy]-1,3,3-triethylurea |
|---|---|
| PubChem CID | 3067549 |
| Molecular Formula | C14H29Cl2N4O4P |
| Molecular Weight | 419.29 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 1-[[2-[bis(2-chloroethyl)amino]-2-oxo-1,3,2lambda5-oxazaphosphinan-4-yl]oxy]-1,3,3-triethylurea |
| SMILES | CCN(CC)C(=O)N(CC)OC1CCOP(=O)(N(CCCl)CCCl)N1 |
| InChI | InChI=1S/C14H29Cl2N4O4P/c1-4-18(5-2)14(21)20(6-3)24-13-7-12-23-25(22,17-13)19(10-8-15)11-9-16/h13H,4-12H2,1-3H3,(H,17,22) |
| InChIKey | CAOWMACJQJMVRK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.29 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|