C6H10N2O5 — CID 3067627
[(3S,3aR,6S,6aS)-3-amino-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrate (PubChem CID 3067627) has the molecular formula C6H10N2O5 and a molecular weight of 190.16 g/mol. Its IUPAC name is [(3S,3aR,6S,6aS)-3-amino-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrate.
| Compound Name | [(3S,3aR,6S,6aS)-3-amino-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrate |
|---|---|
| PubChem CID | 3067627 |
| Molecular Formula | C6H10N2O5 |
| Molecular Weight | 190.16 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | [(3S,3aR,6S,6aS)-3-amino-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrate |
| SMILES | N[C@H]1CO[C@H]2[C@@H]1OC[C@@H]2O[N+](=O)[O-] |
| InChI | InChI=1S/C6H10N2O5/c7-3-1-11-6-4(13-8(9)10)2-12-5(3)6/h3-6H,1-2,7H2/t3-,4-,5+,6+/m0/s1 |
| InChIKey | IOSFCUSLSLNFJT-UNTFVMJOSA-N |
| XLogP | -1.31 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.16 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|