About 4-(butanoylamino)-N,N-di(butan-2-yl)butanamide
4-(butanoylamino)-N,N-di(butan-2-yl)butanamide (PubChem CID 3067791) has the molecular formula C16H32N2O2
and a molecular weight of 284.44 g/mol. Its IUPAC name is 4-(butanoylamino)-N,N-di(butan-2-yl)butanamide.
Molecular Properties
| Compound Name | 4-(butanoylamino)-N,N-di(butan-2-yl)butanamide |
| PubChem CID | 3067791 |
| Molecular Formula | C16H32N2O2 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.25 |
| IUPAC Name | 4-(butanoylamino)-N,N-di(butan-2-yl)butanamide |
| SMILES | CCCC(=O)NCCCC(=O)N(C(C)CC)C(C)CC |
| InChI | InChI=1S/C16H32N2O2/c1-6-10-15(19)17-12-9-11-16(20)18(13(4)7-2)14(5)8-3/h13-14H,6-12H2,1-5H3,(H,17,19) |
| InChIKey | JXYPYSQAEGBVMS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(butanoylamino)-N,N-di(butan-2-yl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(butanoylamino)-N,N-di(butan-2-yl)butanamide?
The IUPAC name of 4-(butanoylamino)-N,N-di(butan-2-yl)butanamide (CID 3067791) is 4-(butanoylamino)-N,N-di(butan-2-yl)butanamide.
What is the SMILES notation for 4-(butanoylamino)-N,N-di(butan-2-yl)butanamide?
The canonical SMILES for 4-(butanoylamino)-N,N-di(butan-2-yl)butanamide is CCCC(=O)NCCCC(=O)N(C(C)CC)C(C)CC.
What is the InChIKey of 4-(butanoylamino)-N,N-di(butan-2-yl)butanamide?
The InChIKey is JXYPYSQAEGBVMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32N2O2/c1-6-10-15(19)17-12-9-11-16(20)18(13(4)7-2)14(5)8-3/h13-14H,6-12H2,1-5H3,(H,17,19).
What are the key properties of 4-(butanoylamino)-N,N-di(butan-2-yl)butanamide?
4-(butanoylamino)-N,N-di(butan-2-yl)butanamide has a molecular weight of 284.44 g/mol, XLogP of 3.11, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(butanoylamino)-N,N-di(butan-2-yl)butanamide is sourced from PubChem (CID 3067791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).