C17H24INO — CID 3067904
3-(3,4-dimethylphenyl)-1-methyl-2-methylidene-1-azoniabicyclo[2.2.2]octan-3-ol iodide (PubChem CID 3067904) has the molecular formula C17H24INO and a molecular weight of 385.29 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-1-methyl-2-methylidene-1-azoniabicyclo[2.2.2]octan-3-ol iodide.
| Compound Name | 3-(3,4-dimethylphenyl)-1-methyl-2-methylidene-1-azoniabicyclo[2.2.2]octan-3-ol iodide |
|---|---|
| PubChem CID | 3067904 |
| Molecular Formula | C17H24INO |
| Molecular Weight | 385.29 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-1-methyl-2-methylidene-1-azoniabicyclo[2.2.2]octan-3-ol iodide |
| SMILES | C=C1C(O)(c2ccc(C)c(C)c2)C2CC[N+]1(C)CC2.[I-] |
| InChI | InChI=1S/C17H24NO.HI/c1-12-5-6-16(11-13(12)2)17(19)14(3)18(4)9-7-15(17)8-10-18;/h5-6,11,15,19H,3,7-10H2,1-2,4H3;1H/q+1;/p-1 |
| InChIKey | KOYPZEXOCSNHCD-UHFFFAOYSA-M |
| XLogP | -0.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.29 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|