About N-(1H-indazol-3-yl)-N',N'-dimethylethane-1,2-diamine
N-(1H-indazol-3-yl)-N',N'-dimethylethane-1,2-diamine (PubChem CID 3068044) has the molecular formula C11H16N4
and a molecular weight of 204.28 g/mol. Its IUPAC name is N-(1H-indazol-3-yl)-N',N'-dimethylethane-1,2-diamine.
Molecular Properties
| Compound Name | N-(1H-indazol-3-yl)-N',N'-dimethylethane-1,2-diamine |
| PubChem CID | 3068044 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | N-(1H-indazol-3-yl)-N',N'-dimethylethane-1,2-diamine |
| SMILES | CN(C)CCNc1n[nH]c2ccccc12 |
| InChI | InChI=1S/C11H16N4/c1-15(2)8-7-12-11-9-5-3-4-6-10(9)13-14-11/h3-6H,7-8H2,1-2H3,(H2,12,13,14) |
| InChIKey | WGACVTNJAJTWFD-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(1H-indazol-3-yl)-N',N'-dimethylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1H-indazol-3-yl)-N',N'-dimethylethane-1,2-diamine?
The IUPAC name of N-(1H-indazol-3-yl)-N',N'-dimethylethane-1,2-diamine (CID 3068044) is N-(1H-indazol-3-yl)-N',N'-dimethylethane-1,2-diamine.
What is the SMILES notation for N-(1H-indazol-3-yl)-N',N'-dimethylethane-1,2-diamine?
The canonical SMILES for N-(1H-indazol-3-yl)-N',N'-dimethylethane-1,2-diamine is CN(C)CCNc1n[nH]c2ccccc12.
What is the InChIKey of N-(1H-indazol-3-yl)-N',N'-dimethylethane-1,2-diamine?
The InChIKey is WGACVTNJAJTWFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4/c1-15(2)8-7-12-11-9-5-3-4-6-10(9)13-14-11/h3-6H,7-8H2,1-2H3,(H2,12,13,14).
What are the key properties of N-(1H-indazol-3-yl)-N',N'-dimethylethane-1,2-diamine?
N-(1H-indazol-3-yl)-N',N'-dimethylethane-1,2-diamine has a molecular weight of 204.28 g/mol, XLogP of 1.54, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1H-indazol-3-yl)-N',N'-dimethylethane-1,2-diamine is sourced from PubChem (CID 3068044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).