C13H14N2O2S — CID 3068073
5-Thiazolecarboxamide, N,4-dimethyl-2-(2-methoxyphenyl)- (PubChem CID 3068073) has the molecular formula C13H14N2O2S and a molecular weight of 262.33 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide.
| Compound Name | 5-Thiazolecarboxamide, N,4-dimethyl-2-(2-methoxyphenyl)- |
|---|---|
| PubChem CID | 3068073 |
| Molecular Formula | C13H14N2O2S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 2-(2-methoxyphenyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide |
| SMILES | CC1=C(SC(=N1)C2=CC=CC=C2OC)C(=O)NC |
| InChI | InChI=1S/C13H14N2O2S/c1-8-11(12(16)14-2)18-13(15-8)9-6-4-5-7-10(9)17-3/h4-7H,1-3H3,(H,14,16) |
| InChIKey | RWQUXMQQPCENOI-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 79.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | 301 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |