About 2-(4-methoxyphenyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide
2-(4-methoxyphenyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide (PubChem CID 3068076) has the molecular formula C13H14N2O2S
and a molecular weight of 262.33 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | 2-(4-methoxyphenyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide |
| PubChem CID | 3068076 |
| Molecular Formula | C13H14N2O2S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 2-(4-methoxyphenyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide |
| SMILES | CNC(=O)c1sc(-c2ccc(OC)cc2)nc1C |
| InChI | InChI=1S/C13H14N2O2S/c1-8-11(12(16)14-2)18-13(15-8)9-4-6-10(17-3)7-5-9/h4-7H,1-3H3,(H,14,16) |
| InChIKey | GPLLJBLZFRBIEX-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-methoxyphenyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methoxyphenyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide?
The IUPAC name of 2-(4-methoxyphenyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide (CID 3068076) is 2-(4-methoxyphenyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide.
What is the SMILES notation for 2-(4-methoxyphenyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide?
The canonical SMILES for 2-(4-methoxyphenyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide is CNC(=O)c1sc(-c2ccc(OC)cc2)nc1C.
What is the InChIKey of 2-(4-methoxyphenyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide?
The InChIKey is GPLLJBLZFRBIEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O2S/c1-8-11(12(16)14-2)18-13(15-8)9-4-6-10(17-3)7-5-9/h4-7H,1-3H3,(H,14,16).
What are the key properties of 2-(4-methoxyphenyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide?
2-(4-methoxyphenyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide has a molecular weight of 262.33 g/mol, XLogP of 2.49, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methoxyphenyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 3068076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).