C16H32N6 — CID 3068113
N,N'-bis(4,5,6,7-tetrahydro-1H-1,3-diazepin-2-yl)hexane-1,6-diamine (PubChem CID 3068113) has the molecular formula C16H32N6 and a molecular weight of 308.47 g/mol. Its IUPAC name is N,N'-bis(4,5,6,7-tetrahydro-1H-1,3-diazepin-2-yl)hexane-1,6-diamine.
| Compound Name | N,N'-bis(4,5,6,7-tetrahydro-1H-1,3-diazepin-2-yl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 3068113 |
| Molecular Formula | C16H32N6 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.27 |
| IUPAC Name | N,N'-bis(4,5,6,7-tetrahydro-1H-1,3-diazepin-2-yl)hexane-1,6-diamine |
| SMILES | C(CCCNC1=NCCCCN1)CCNC1=NCCCCN1 |
| InChI | InChI=1S/C16H32N6/c1(3-9-17-15-19-11-5-6-12-20-15)2-4-10-18-16-21-13-7-8-14-22-16/h1-14H2,(H2,17,19,20)(H2,18,21,22) |
| InChIKey | GBPVANCSGSTCKC-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 72.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|