C18H38I2N6O3 — CID 3068118
N-[2-[2-[2-[2-(4,5,6,7-tetrahydro-1H-1,3-diazepin-2-ylamino)ethoxy]ethoxy]ethoxy]ethyl]-4,5,6,7-tetrahydro-1H-1,3-diazepin-2-amine;dihydroiodide (PubChem CID 3068118) has the molecular formula C18H38I2N6O3 and a molecular weight of 640.35 g/mol. Its IUPAC name is N-[2-[2-[2-[2-(4,5,6,7-tetrahydro-1H-1,3-diazepin-2-ylamino)ethoxy]ethoxy]ethoxy]ethyl]-4,5,6,7-tetrahydro-1H-1,3-diazepin-2-amine;dihydroiodide.
| Compound Name | N-[2-[2-[2-[2-(4,5,6,7-tetrahydro-1H-1,3-diazepin-2-ylamino)ethoxy]ethoxy]ethoxy]ethyl]-4,5,6,7-tetrahydro-1H-1,3-diazepin-2-amine;dihydroiodide |
|---|---|
| PubChem CID | 3068118 |
| Molecular Formula | C18H38I2N6O3 |
| Molecular Weight | 640.35 g/mol |
| Exact Mass | 640.11 |
| IUPAC Name | N-[2-[2-[2-[2-(4,5,6,7-tetrahydro-1H-1,3-diazepin-2-ylamino)ethoxy]ethoxy]ethoxy]ethyl]-4,5,6,7-tetrahydro-1H-1,3-diazepin-2-amine;dihydroiodide |
| SMILES | C1CCNC(NCCOCCOCCOCCNC2=NCCCCN2)=NC1.I.I |
| InChI | InChI=1S/C18H36N6O3.2HI/c1-2-6-20-17(19-5-1)23-9-11-25-13-15-27-16-14-26-12-10-24-18-21-7-3-4-8-22-18;;/h1-16H2,(H2,19,20,23)(H2,21,22,24);2*1H |
| InChIKey | BNYJBPYRGPPPGC-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 100.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.35 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|