About (6-chloro-4H-1,3-benzodioxin-8-yl)methyl 4-(tetrazol-1-yl)benzoate
(6-chloro-4H-1,3-benzodioxin-8-yl)methyl 4-(tetrazol-1-yl)benzoate (PubChem CID 30686703) has the molecular formula C17H13ClN4O4
and a molecular weight of 372.77 g/mol. Its IUPAC name is (6-chloro-4H-1,3-benzodioxin-8-yl)methyl 4-(tetrazol-1-yl)benzoate.
Molecular Properties
| Compound Name | (6-chloro-4H-1,3-benzodioxin-8-yl)methyl 4-(tetrazol-1-yl)benzoate |
| PubChem CID | 30686703 |
| Molecular Formula | C17H13ClN4O4 |
| Molecular Weight | 372.77 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | (6-chloro-4H-1,3-benzodioxin-8-yl)methyl 4-(tetrazol-1-yl)benzoate |
| SMILES | O=C(OCc1cc(Cl)cc2c1OCOC2)c1ccc(-n2cnnn2)cc1 |
| InChI | InChI=1S/C17H13ClN4O4/c18-14-5-12-7-24-10-26-16(12)13(6-14)8-25-17(23)11-1-3-15(4-2-11)22-9-19-20-21-22/h1-6,9H,7-8,10H2 |
| InChIKey | OBVLSFRJKYKTPE-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 88.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.77 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze (6-chloro-4H-1,3-benzodioxin-8-yl)methyl 4-(tetrazol-1-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chloro-4H-1,3-benzodioxin-8-yl)methyl 4-(tetrazol-1-yl)benzoate?
The IUPAC name of (6-chloro-4H-1,3-benzodioxin-8-yl)methyl 4-(tetrazol-1-yl)benzoate (CID 30686703) is (6-chloro-4H-1,3-benzodioxin-8-yl)methyl 4-(tetrazol-1-yl)benzoate.
What is the SMILES notation for (6-chloro-4H-1,3-benzodioxin-8-yl)methyl 4-(tetrazol-1-yl)benzoate?
The canonical SMILES for (6-chloro-4H-1,3-benzodioxin-8-yl)methyl 4-(tetrazol-1-yl)benzoate is O=C(OCc1cc(Cl)cc2c1OCOC2)c1ccc(-n2cnnn2)cc1.
What is the InChIKey of (6-chloro-4H-1,3-benzodioxin-8-yl)methyl 4-(tetrazol-1-yl)benzoate?
The InChIKey is OBVLSFRJKYKTPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13ClN4O4/c18-14-5-12-7-24-10-26-16(12)13(6-14)8-25-17(23)11-1-3-15(4-2-11)22-9-19-20-21-22/h1-6,9H,7-8,10H2.
What are the key properties of (6-chloro-4H-1,3-benzodioxin-8-yl)methyl 4-(tetrazol-1-yl)benzoate?
(6-chloro-4H-1,3-benzodioxin-8-yl)methyl 4-(tetrazol-1-yl)benzoate has a molecular weight of 372.77 g/mol, XLogP of 2.54, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloro-4H-1,3-benzodioxin-8-yl)methyl 4-(tetrazol-1-yl)benzoate is sourced from PubChem (CID 30686703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).