C15H9Cl3O2 — CID 3068791
(4-chlorophenyl)-(5,7-dichloro-1-benzofuran-2-yl)methanol (PubChem CID 3068791) has the molecular formula C15H9Cl3O2 and a molecular weight of 327.59 g/mol. Its IUPAC name is (4-chlorophenyl)-(5,7-dichloro-1-benzofuran-2-yl)methanol.
| Compound Name | (4-chlorophenyl)-(5,7-dichloro-1-benzofuran-2-yl)methanol |
|---|---|
| PubChem CID | 3068791 |
| Molecular Formula | C15H9Cl3O2 |
| Molecular Weight | 327.59 g/mol |
| Exact Mass | 325.97 |
| IUPAC Name | (4-chlorophenyl)-(5,7-dichloro-1-benzofuran-2-yl)methanol |
| SMILES | OC(c1ccc(Cl)cc1)c1cc2cc(Cl)cc(Cl)c2o1 |
| InChI | InChI=1S/C15H9Cl3O2/c16-10-3-1-8(2-4-10)14(19)13-6-9-5-11(17)7-12(18)15(9)20-13/h1-7,14,19H |
| InChIKey | IJPZZRUJQUFAAM-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.59 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |