C23H28N4O — CID 3068869
N-ethyl-N'-(9-methoxy-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-1-yl)propane-1,3-diamine (PubChem CID 3068869) has the molecular formula C23H28N4O and a molecular weight of 376.50 g/mol. Its IUPAC name is N-ethyl-N'-(9-methoxy-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-1-yl)propane-1,3-diamine.
| Compound Name | N-ethyl-N'-(9-methoxy-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-1-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 3068869 |
| Molecular Formula | C23H28N4O |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | N-ethyl-N'-(9-methoxy-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-1-yl)propane-1,3-diamine |
| SMILES | CCNCCCNc1nccc2c(C)c3[nH]c4ccc(OC)cc4c3c(C)c12 |
| InChI | InChI=1S/C23H28N4O/c1-5-24-10-6-11-25-23-21-15(3)20-18-13-16(28-4)7-8-19(18)27-22(20)14(2)17(21)9-12-26-23/h7-9,12-13,24,27H,5-6,10-11H2,1-4H3,(H,25,26) |
| InChIKey | VIWUDYABBPMENV-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 61.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|