C18H38O2 — CID 3069683
2,11-diethyl-2,11-dimethyldodecane-1,12-diol (PubChem CID 3069683) has the molecular formula C18H38O2 and a molecular weight of 286.50 g/mol. Its IUPAC name is 2,11-diethyl-2,11-dimethyldodecane-1,12-diol.
| Compound Name | 2,11-diethyl-2,11-dimethyldodecane-1,12-diol |
|---|---|
| PubChem CID | 3069683 |
| Molecular Formula | C18H38O2 |
| Molecular Weight | 286.50 g/mol |
| Exact Mass | 286.29 |
| IUPAC Name | 2,11-diethyl-2,11-dimethyldodecane-1,12-diol |
| SMILES | CCC(C)(CO)CCCCCCCCC(C)(CC)CO |
| InChI | InChI=1S/C18H38O2/c1-5-17(3,15-19)13-11-9-7-8-10-12-14-18(4,6-2)16-20/h19-20H,5-16H2,1-4H3 |
| InChIKey | TYLRFGPJTUPMPD-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.50 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|