C16H30O4 — CID 3069693
2,9-diethyl-2,9-dimethyldecanedioic acid (PubChem CID 3069693) has the molecular formula C16H30O4 and a molecular weight of 286.41 g/mol. Its IUPAC name is 2,9-diethyl-2,9-dimethyldecanedioic acid.
| Compound Name | 2,9-diethyl-2,9-dimethyldecanedioic acid |
|---|---|
| PubChem CID | 3069693 |
| Molecular Formula | C16H30O4 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | 2,9-diethyl-2,9-dimethyldecanedioic acid |
| SMILES | CCC(C)(CCCCCCC(C)(CC)C(=O)O)C(=O)O |
| InChI | InChI=1S/C16H30O4/c1-5-15(3,13(17)18)11-9-7-8-10-12-16(4,6-2)14(19)20/h5-12H2,1-4H3,(H,17,18)(H,19,20) |
| InChIKey | LXRXTKJTPPFGFN-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|