About 2,9-dimethyl-2,9-dipropyldecanedioic acid
2,9-dimethyl-2,9-dipropyldecanedioic acid (PubChem CID 3069694) has the molecular formula C18H34O4
and a molecular weight of 314.47 g/mol. Its IUPAC name is 2,9-dimethyl-2,9-dipropyldecanedioic acid.
Molecular Properties
| Compound Name | 2,9-dimethyl-2,9-dipropyldecanedioic acid |
| PubChem CID | 3069694 |
| Molecular Formula | C18H34O4 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | 2,9-dimethyl-2,9-dipropyldecanedioic acid |
| SMILES | CCCC(C)(CCCCCCC(C)(CCC)C(=O)O)C(=O)O |
| InChI | InChI=1S/C18H34O4/c1-5-11-17(3,15(19)20)13-9-7-8-10-14-18(4,12-6-2)16(21)22/h5-14H2,1-4H3,(H,19,20)(H,21,22) |
| InChIKey | VAQOGBCLEIYWDM-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,9-dimethyl-2,9-dipropyldecanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,9-dimethyl-2,9-dipropyldecanedioic acid?
The IUPAC name of 2,9-dimethyl-2,9-dipropyldecanedioic acid (CID 3069694) is 2,9-dimethyl-2,9-dipropyldecanedioic acid.
What is the SMILES notation for 2,9-dimethyl-2,9-dipropyldecanedioic acid?
The canonical SMILES for 2,9-dimethyl-2,9-dipropyldecanedioic acid is CCCC(C)(CCCCCCC(C)(CCC)C(=O)O)C(=O)O.
What is the InChIKey of 2,9-dimethyl-2,9-dipropyldecanedioic acid?
The InChIKey is VAQOGBCLEIYWDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34O4/c1-5-11-17(3,15(19)20)13-9-7-8-10-14-18(4,12-6-2)16(21)22/h5-14H2,1-4H3,(H,19,20)(H,21,22).
What are the key properties of 2,9-dimethyl-2,9-dipropyldecanedioic acid?
2,9-dimethyl-2,9-dipropyldecanedioic acid has a molecular weight of 314.47 g/mol, XLogP of 5.11, 13 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,9-dimethyl-2,9-dipropyldecanedioic acid is sourced from PubChem (CID 3069694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).