About 2,9-dibutyl-2,9-dimethyldecanedioic acid
2,9-dibutyl-2,9-dimethyldecanedioic acid (PubChem CID 3069695) has the molecular formula C20H38O4
and a molecular weight of 342.52 g/mol. Its IUPAC name is 2,9-dibutyl-2,9-dimethyldecanedioic acid.
Molecular Properties
| Compound Name | 2,9-dibutyl-2,9-dimethyldecanedioic acid |
| PubChem CID | 3069695 |
| Molecular Formula | C20H38O4 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.28 |
| IUPAC Name | 2,9-dibutyl-2,9-dimethyldecanedioic acid |
| SMILES | CCCCC(C)(CCCCCCC(C)(CCCC)C(=O)O)C(=O)O |
| InChI | InChI=1S/C20H38O4/c1-5-7-13-19(3,17(21)22)15-11-9-10-12-16-20(4,18(23)24)14-8-6-2/h5-16H2,1-4H3,(H,21,22)(H,23,24) |
| InChIKey | CCOJGVDLLKCGCI-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,9-dibutyl-2,9-dimethyldecanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,9-dibutyl-2,9-dimethyldecanedioic acid?
The IUPAC name of 2,9-dibutyl-2,9-dimethyldecanedioic acid (CID 3069695) is 2,9-dibutyl-2,9-dimethyldecanedioic acid.
What is the SMILES notation for 2,9-dibutyl-2,9-dimethyldecanedioic acid?
The canonical SMILES for 2,9-dibutyl-2,9-dimethyldecanedioic acid is CCCCC(C)(CCCCCCC(C)(CCCC)C(=O)O)C(=O)O.
What is the InChIKey of 2,9-dibutyl-2,9-dimethyldecanedioic acid?
The InChIKey is CCOJGVDLLKCGCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H38O4/c1-5-7-13-19(3,17(21)22)15-11-9-10-12-16-20(4,18(23)24)14-8-6-2/h5-16H2,1-4H3,(H,21,22)(H,23,24).
What are the key properties of 2,9-dibutyl-2,9-dimethyldecanedioic acid?
2,9-dibutyl-2,9-dimethyldecanedioic acid has a molecular weight of 342.52 g/mol, XLogP of 5.89, 15 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,9-dibutyl-2,9-dimethyldecanedioic acid is sourced from PubChem (CID 3069695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).