About 2,10-diethyl-2,10-dimethylundecanedioic acid
2,10-diethyl-2,10-dimethylundecanedioic acid (PubChem CID 3069696) has the molecular formula C17H32O4
and a molecular weight of 300.44 g/mol. Its IUPAC name is 2,10-diethyl-2,10-dimethylundecanedioic acid.
Molecular Properties
| Compound Name | 2,10-diethyl-2,10-dimethylundecanedioic acid |
| PubChem CID | 3069696 |
| Molecular Formula | C17H32O4 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | 2,10-diethyl-2,10-dimethylundecanedioic acid |
| SMILES | CCC(C)(CCCCCCCC(C)(CC)C(=O)O)C(=O)O |
| InChI | InChI=1S/C17H32O4/c1-5-16(3,14(18)19)12-10-8-7-9-11-13-17(4,6-2)15(20)21/h5-13H2,1-4H3,(H,18,19)(H,20,21) |
| InChIKey | RZLJOODBPHKSCF-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,10-diethyl-2,10-dimethylundecanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,10-diethyl-2,10-dimethylundecanedioic acid?
The IUPAC name of 2,10-diethyl-2,10-dimethylundecanedioic acid (CID 3069696) is 2,10-diethyl-2,10-dimethylundecanedioic acid.
What is the SMILES notation for 2,10-diethyl-2,10-dimethylundecanedioic acid?
The canonical SMILES for 2,10-diethyl-2,10-dimethylundecanedioic acid is CCC(C)(CCCCCCCC(C)(CC)C(=O)O)C(=O)O.
What is the InChIKey of 2,10-diethyl-2,10-dimethylundecanedioic acid?
The InChIKey is RZLJOODBPHKSCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32O4/c1-5-16(3,14(18)19)12-10-8-7-9-11-13-17(4,6-2)15(20)21/h5-13H2,1-4H3,(H,18,19)(H,20,21).
What are the key properties of 2,10-diethyl-2,10-dimethylundecanedioic acid?
2,10-diethyl-2,10-dimethylundecanedioic acid has a molecular weight of 300.44 g/mol, XLogP of 4.72, 12 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,10-diethyl-2,10-dimethylundecanedioic acid is sourced from PubChem (CID 3069696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).