C17H19N3O3S — CID 30697500
N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-3-pyridin-3-ylpropanamide (PubChem CID 30697500) has the molecular formula C17H19N3O3S and a molecular weight of 345.42 g/mol. Its IUPAC name is N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-3-pyridin-3-ylpropanamide.
| Compound Name | N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-3-pyridin-3-ylpropanamide |
|---|---|
| PubChem CID | 30697500 |
| Molecular Formula | C17H19N3O3S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-3-pyridin-3-ylpropanamide |
| SMILES | O=C(CCc1cccnc1)Nc1ccc(N2CCCS2(=O)=O)cc1 |
| InChI | InChI=1S/C17H19N3O3S/c21-17(9-4-14-3-1-10-18-13-14)19-15-5-7-16(8-6-15)20-11-2-12-24(20,22)23/h1,3,5-8,10,13H,2,4,9,11-12H2,(H,19,21) |
| InChIKey | JKDVLIFJTWBIDD-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |