About N-(dicyclopropylmethyl)-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]acetamide
N-(dicyclopropylmethyl)-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]acetamide (PubChem CID 30699472) has the molecular formula C15H22N2O2S
and a molecular weight of 294.42 g/mol. Its IUPAC name is N-(dicyclopropylmethyl)-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]acetamide.
Molecular Properties
| Compound Name | N-(dicyclopropylmethyl)-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]acetamide |
| PubChem CID | 30699472 |
| Molecular Formula | C15H22N2O2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | N-(dicyclopropylmethyl)-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]acetamide |
| SMILES | Cc1noc(C)c1CSCC(=O)NC(C1CC1)C1CC1 |
| InChI | InChI=1S/C15H22N2O2S/c1-9-13(10(2)19-17-9)7-20-8-14(18)16-15(11-3-4-11)12-5-6-12/h11-12,15H,3-8H2,1-2H3,(H,16,18) |
| InChIKey | YYMLVTMJSDFSDM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(dicyclopropylmethyl)-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(dicyclopropylmethyl)-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]acetamide?
The IUPAC name of N-(dicyclopropylmethyl)-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]acetamide (CID 30699472) is N-(dicyclopropylmethyl)-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]acetamide.
What is the SMILES notation for N-(dicyclopropylmethyl)-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]acetamide?
The canonical SMILES for N-(dicyclopropylmethyl)-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]acetamide is Cc1noc(C)c1CSCC(=O)NC(C1CC1)C1CC1.
What is the InChIKey of N-(dicyclopropylmethyl)-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]acetamide?
The InChIKey is YYMLVTMJSDFSDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O2S/c1-9-13(10(2)19-17-9)7-20-8-14(18)16-15(11-3-4-11)12-5-6-12/h11-12,15H,3-8H2,1-2H3,(H,16,18).
What are the key properties of N-(dicyclopropylmethyl)-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]acetamide?
N-(dicyclopropylmethyl)-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]acetamide has a molecular weight of 294.42 g/mol, XLogP of 2.83, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(dicyclopropylmethyl)-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]acetamide is sourced from PubChem (CID 30699472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).