About 6-butyl-4-methyl-7-phenylpurino[7,8-a]imidazole-1,3-dione
6-butyl-4-methyl-7-phenylpurino[7,8-a]imidazole-1,3-dione (PubChem CID 3069971) has the molecular formula C18H19N5O2
and a molecular weight of 337.38 g/mol. Its IUPAC name is 6-butyl-4-methyl-7-phenylpurino[7,8-a]imidazole-1,3-dione.
Molecular Properties
| Compound Name | 6-butyl-4-methyl-7-phenylpurino[7,8-a]imidazole-1,3-dione |
| PubChem CID | 3069971 |
| Molecular Formula | C18H19N5O2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 6-butyl-4-methyl-7-phenylpurino[7,8-a]imidazole-1,3-dione |
| SMILES | CCCCn1c(-c2ccccc2)cn2c3c(=O)[nH]c(=O)n(C)c3nc12 |
| InChI | InChI=1S/C18H19N5O2/c1-3-4-10-22-13(12-8-6-5-7-9-12)11-23-14-15(19-17(22)23)21(2)18(25)20-16(14)24/h5-9,11H,3-4,10H2,1-2H3,(H,20,24,25) |
| InChIKey | WFEZMDMNDVDXDW-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 77.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-butyl-4-methyl-7-phenylpurino[7,8-a]imidazole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-butyl-4-methyl-7-phenylpurino[7,8-a]imidazole-1,3-dione?
The IUPAC name of 6-butyl-4-methyl-7-phenylpurino[7,8-a]imidazole-1,3-dione (CID 3069971) is 6-butyl-4-methyl-7-phenylpurino[7,8-a]imidazole-1,3-dione.
What is the SMILES notation for 6-butyl-4-methyl-7-phenylpurino[7,8-a]imidazole-1,3-dione?
The canonical SMILES for 6-butyl-4-methyl-7-phenylpurino[7,8-a]imidazole-1,3-dione is CCCCn1c(-c2ccccc2)cn2c3c(=O)[nH]c(=O)n(C)c3nc12.
What is the InChIKey of 6-butyl-4-methyl-7-phenylpurino[7,8-a]imidazole-1,3-dione?
The InChIKey is WFEZMDMNDVDXDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N5O2/c1-3-4-10-22-13(12-8-6-5-7-9-12)11-23-14-15(19-17(22)23)21(2)18(25)20-16(14)24/h5-9,11H,3-4,10H2,1-2H3,(H,20,24,25).
What are the key properties of 6-butyl-4-methyl-7-phenylpurino[7,8-a]imidazole-1,3-dione?
6-butyl-4-methyl-7-phenylpurino[7,8-a]imidazole-1,3-dione has a molecular weight of 337.38 g/mol, XLogP of 2.14, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-butyl-4-methyl-7-phenylpurino[7,8-a]imidazole-1,3-dione is sourced from PubChem (CID 3069971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).