About N-(4-cyclopentylphenyl)-N',N'-diethylethane-1,2-diamine;dihydrochloride
N-(4-cyclopentylphenyl)-N',N'-diethylethane-1,2-diamine;dihydrochloride (PubChem CID 3069985) has the molecular formula C17H30Cl2N2
and a molecular weight of 333.35 g/mol. Its IUPAC name is N-(4-cyclopentylphenyl)-N',N'-diethylethane-1,2-diamine;dihydrochloride.
Molecular Properties
| Compound Name | N-(4-cyclopentylphenyl)-N',N'-diethylethane-1,2-diamine;dihydrochloride |
| PubChem CID | 3069985 |
| Molecular Formula | C17H30Cl2N2 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | N-(4-cyclopentylphenyl)-N',N'-diethylethane-1,2-diamine;dihydrochloride |
| SMILES | CCN(CC)CCNc1ccc(C2CCCC2)cc1.Cl.Cl |
| InChI | InChI=1S/C17H28N2.2ClH/c1-3-19(4-2)14-13-18-17-11-9-16(10-12-17)15-7-5-6-8-15;;/h9-12,15,18H,3-8,13-14H2,1-2H3;2*1H |
| InChIKey | XIDSGLLQUYRZGG-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_alk_D(1)', 'substructure': 'N/A'} |
|---|
Analyze N-(4-cyclopentylphenyl)-N',N'-diethylethane-1,2-diamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-cyclopentylphenyl)-N',N'-diethylethane-1,2-diamine;dihydrochloride?
The IUPAC name of N-(4-cyclopentylphenyl)-N',N'-diethylethane-1,2-diamine;dihydrochloride (CID 3069985) is N-(4-cyclopentylphenyl)-N',N'-diethylethane-1,2-diamine;dihydrochloride.
What is the SMILES notation for N-(4-cyclopentylphenyl)-N',N'-diethylethane-1,2-diamine;dihydrochloride?
The canonical SMILES for N-(4-cyclopentylphenyl)-N',N'-diethylethane-1,2-diamine;dihydrochloride is CCN(CC)CCNc1ccc(C2CCCC2)cc1.Cl.Cl.
What is the InChIKey of N-(4-cyclopentylphenyl)-N',N'-diethylethane-1,2-diamine;dihydrochloride?
The InChIKey is XIDSGLLQUYRZGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N2.2ClH/c1-3-19(4-2)14-13-18-17-11-9-16(10-12-17)15-7-5-6-8-15;;/h9-12,15,18H,3-8,13-14H2,1-2H3;2*1H.
What are the key properties of N-(4-cyclopentylphenyl)-N',N'-diethylethane-1,2-diamine;dihydrochloride?
N-(4-cyclopentylphenyl)-N',N'-diethylethane-1,2-diamine;dihydrochloride has a molecular weight of 333.35 g/mol, XLogP of 4.94, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-cyclopentylphenyl)-N',N'-diethylethane-1,2-diamine;dihydrochloride is sourced from PubChem (CID 3069985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).