C17H28N2 — CID 3069986
N-(4-cyclopentylphenyl)-N',N'-diethylethane-1,2-diamine (PubChem CID 3069986) has the molecular formula C17H28N2 and a molecular weight of 260.42 g/mol. Its IUPAC name is N-(4-cyclopentylphenyl)-N',N'-diethylethane-1,2-diamine.
| Compound Name | N-(4-cyclopentylphenyl)-N',N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 3069986 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | N-(4-cyclopentylphenyl)-N',N'-diethylethane-1,2-diamine |
| SMILES | CCN(CC)CCNc1ccc(C2CCCC2)cc1 |
| InChI | InChI=1S/C17H28N2/c1-3-19(4-2)14-13-18-17-11-9-16(10-12-17)15-7-5-6-8-15/h9-12,15,18H,3-8,13-14H2,1-2H3 |
| InChIKey | CWHKKBQPROZYFG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_D(1)', 'substructure': 'N/A'} |
|---|