C27H34BrN2P — CID 3070061
1,3-dibenzyl-5-butyl-5-phenyl-1,3,5-diazaphosphinan-5-ium bromide (PubChem CID 3070061) has the molecular formula C27H34BrN2P and a molecular weight of 497.46 g/mol. Its IUPAC name is 1,3-dibenzyl-5-butyl-5-phenyl-1,3,5-diazaphosphinan-5-ium bromide.
| Compound Name | 1,3-dibenzyl-5-butyl-5-phenyl-1,3,5-diazaphosphinan-5-ium bromide |
|---|---|
| PubChem CID | 3070061 |
| Molecular Formula | C27H34BrN2P |
| Molecular Weight | 497.46 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | 1,3-dibenzyl-5-butyl-5-phenyl-1,3,5-diazaphosphinan-5-ium bromide |
| SMILES | CCCC[P+]1(c2ccccc2)CN(Cc2ccccc2)CN(Cc2ccccc2)C1.[Br-] |
| InChI | InChI=1S/C27H34N2P.BrH/c1-2-3-19-30(27-17-11-6-12-18-27)23-28(20-25-13-7-4-8-14-25)22-29(24-30)21-26-15-9-5-10-16-26;/h4-18H,2-3,19-24H2,1H3;1H/q+1;/p-1 |
| InChIKey | HCXBKULFHDJBEV-UHFFFAOYSA-M |
| XLogP | 3.02 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|