About 6-chloro-N,2-dimethyl-5-prop-2-enylpyrimidin-4-amine
6-chloro-N,2-dimethyl-5-prop-2-enylpyrimidin-4-amine (PubChem CID 3070102) has the molecular formula C9H12ClN3
and a molecular weight of 197.67 g/mol. Its IUPAC name is 6-chloro-N,2-dimethyl-5-prop-2-enylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-chloro-N,2-dimethyl-5-prop-2-enylpyrimidin-4-amine |
| PubChem CID | 3070102 |
| Molecular Formula | C9H12ClN3 |
| Molecular Weight | 197.67 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 6-chloro-N,2-dimethyl-5-prop-2-enylpyrimidin-4-amine |
| SMILES | C=CCc1c(Cl)nc(C)nc1NC |
| InChI | InChI=1S/C9H12ClN3/c1-4-5-7-8(10)12-6(2)13-9(7)11-3/h4H,1,5H2,2-3H3,(H,11,12,13) |
| InChIKey | MPFXSVYHELXCRV-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.67 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-N,2-dimethyl-5-prop-2-enylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N,2-dimethyl-5-prop-2-enylpyrimidin-4-amine?
The IUPAC name of 6-chloro-N,2-dimethyl-5-prop-2-enylpyrimidin-4-amine (CID 3070102) is 6-chloro-N,2-dimethyl-5-prop-2-enylpyrimidin-4-amine.
What is the SMILES notation for 6-chloro-N,2-dimethyl-5-prop-2-enylpyrimidin-4-amine?
The canonical SMILES for 6-chloro-N,2-dimethyl-5-prop-2-enylpyrimidin-4-amine is C=CCc1c(Cl)nc(C)nc1NC.
What is the InChIKey of 6-chloro-N,2-dimethyl-5-prop-2-enylpyrimidin-4-amine?
The InChIKey is MPFXSVYHELXCRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12ClN3/c1-4-5-7-8(10)12-6(2)13-9(7)11-3/h4H,1,5H2,2-3H3,(H,11,12,13).
What are the key properties of 6-chloro-N,2-dimethyl-5-prop-2-enylpyrimidin-4-amine?
6-chloro-N,2-dimethyl-5-prop-2-enylpyrimidin-4-amine has a molecular weight of 197.67 g/mol, XLogP of 2.21, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N,2-dimethyl-5-prop-2-enylpyrimidin-4-amine is sourced from PubChem (CID 3070102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).