About 2-[[6-chloro-5-(2,3-dibromopropyl)-2-methylpyrimidin-4-yl]amino]ethanol
2-[[6-chloro-5-(2,3-dibromopropyl)-2-methylpyrimidin-4-yl]amino]ethanol (PubChem CID 3070105) has the molecular formula C10H14Br2ClN3O
and a molecular weight of 387.50 g/mol. Its IUPAC name is 2-[[6-chloro-5-(2,3-dibromopropyl)-2-methylpyrimidin-4-yl]amino]ethanol.
Molecular Properties
| Compound Name | 2-[[6-chloro-5-(2,3-dibromopropyl)-2-methylpyrimidin-4-yl]amino]ethanol |
| PubChem CID | 3070105 |
| Molecular Formula | C10H14Br2ClN3O |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 384.92 |
| IUPAC Name | 2-[[6-chloro-5-(2,3-dibromopropyl)-2-methylpyrimidin-4-yl]amino]ethanol |
| SMILES | Cc1nc(Cl)c(CC(Br)CBr)c(NCCO)n1 |
| InChI | InChI=1S/C10H14Br2ClN3O/c1-6-15-9(13)8(4-7(12)5-11)10(16-6)14-2-3-17/h7,17H,2-5H2,1H3,(H,14,15,16) |
| InChIKey | CSTQNFUDUSOIRH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[[6-chloro-5-(2,3-dibromopropyl)-2-methylpyrimidin-4-yl]amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[6-chloro-5-(2,3-dibromopropyl)-2-methylpyrimidin-4-yl]amino]ethanol?
The IUPAC name of 2-[[6-chloro-5-(2,3-dibromopropyl)-2-methylpyrimidin-4-yl]amino]ethanol (CID 3070105) is 2-[[6-chloro-5-(2,3-dibromopropyl)-2-methylpyrimidin-4-yl]amino]ethanol.
What is the SMILES notation for 2-[[6-chloro-5-(2,3-dibromopropyl)-2-methylpyrimidin-4-yl]amino]ethanol?
The canonical SMILES for 2-[[6-chloro-5-(2,3-dibromopropyl)-2-methylpyrimidin-4-yl]amino]ethanol is Cc1nc(Cl)c(CC(Br)CBr)c(NCCO)n1.
What is the InChIKey of 2-[[6-chloro-5-(2,3-dibromopropyl)-2-methylpyrimidin-4-yl]amino]ethanol?
The InChIKey is CSTQNFUDUSOIRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14Br2ClN3O/c1-6-15-9(13)8(4-7(12)5-11)10(16-6)14-2-3-17/h7,17H,2-5H2,1H3,(H,14,15,16).
What are the key properties of 2-[[6-chloro-5-(2,3-dibromopropyl)-2-methylpyrimidin-4-yl]amino]ethanol?
2-[[6-chloro-5-(2,3-dibromopropyl)-2-methylpyrimidin-4-yl]amino]ethanol has a molecular weight of 387.50 g/mol, XLogP of 2.54, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[6-chloro-5-(2,3-dibromopropyl)-2-methylpyrimidin-4-yl]amino]ethanol is sourced from PubChem (CID 3070105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).