About 3-butyl-1-(4,5-dihydroxypentyl)-7-methylpurine-2,6-dione
3-butyl-1-(4,5-dihydroxypentyl)-7-methylpurine-2,6-dione (PubChem CID 3070272) has the molecular formula C15H24N4O4
and a molecular weight of 324.38 g/mol. Its IUPAC name is 3-butyl-1-(4,5-dihydroxypentyl)-7-methylpurine-2,6-dione.
Molecular Properties
| Compound Name | 3-butyl-1-(4,5-dihydroxypentyl)-7-methylpurine-2,6-dione |
| PubChem CID | 3070272 |
| Molecular Formula | C15H24N4O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 3-butyl-1-(4,5-dihydroxypentyl)-7-methylpurine-2,6-dione |
| SMILES | CCCCn1c(=O)n(CCCC(O)CO)c(=O)c2c1ncn2C |
| InChI | InChI=1S/C15H24N4O4/c1-3-4-7-18-13-12(17(2)10-16-13)14(22)19(15(18)23)8-5-6-11(21)9-20/h10-11,20-21H,3-9H2,1-2H3 |
| InChIKey | DUTVLFGDRFPFIQ-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 102.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 3-butyl-1-(4,5-dihydroxypentyl)-7-methylpurine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-1-(4,5-dihydroxypentyl)-7-methylpurine-2,6-dione?
The IUPAC name of 3-butyl-1-(4,5-dihydroxypentyl)-7-methylpurine-2,6-dione (CID 3070272) is 3-butyl-1-(4,5-dihydroxypentyl)-7-methylpurine-2,6-dione.
What is the SMILES notation for 3-butyl-1-(4,5-dihydroxypentyl)-7-methylpurine-2,6-dione?
The canonical SMILES for 3-butyl-1-(4,5-dihydroxypentyl)-7-methylpurine-2,6-dione is CCCCn1c(=O)n(CCCC(O)CO)c(=O)c2c1ncn2C.
What is the InChIKey of 3-butyl-1-(4,5-dihydroxypentyl)-7-methylpurine-2,6-dione?
The InChIKey is DUTVLFGDRFPFIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N4O4/c1-3-4-7-18-13-12(17(2)10-16-13)14(22)19(15(18)23)8-5-6-11(21)9-20/h10-11,20-21H,3-9H2,1-2H3.
What are the key properties of 3-butyl-1-(4,5-dihydroxypentyl)-7-methylpurine-2,6-dione?
3-butyl-1-(4,5-dihydroxypentyl)-7-methylpurine-2,6-dione has a molecular weight of 324.38 g/mol, XLogP of -0.17, 8 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-1-(4,5-dihydroxypentyl)-7-methylpurine-2,6-dione is sourced from PubChem (CID 3070272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).