About methyl 4-hydroxy-1,1-dimethylpiperidin-1-ium-3-carboxylate iodide
methyl 4-hydroxy-1,1-dimethylpiperidin-1-ium-3-carboxylate iodide (PubChem CID 3070302) has the molecular formula C9H18INO3
and a molecular weight of 315.15 g/mol. Its IUPAC name is methyl 4-hydroxy-1,1-dimethylpiperidin-1-ium-3-carboxylate iodide.
Molecular Properties
| Compound Name | methyl 4-hydroxy-1,1-dimethylpiperidin-1-ium-3-carboxylate iodide |
| PubChem CID | 3070302 |
| Molecular Formula | C9H18INO3 |
| Molecular Weight | 315.15 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | methyl 4-hydroxy-1,1-dimethylpiperidin-1-ium-3-carboxylate iodide |
| SMILES | COC(=O)C1C[N+](C)(C)CCC1O.[I-] |
| InChI | InChI=1S/C9H18NO3.HI/c1-10(2)5-4-8(11)7(6-10)9(12)13-3;/h7-8,11H,4-6H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | MFURBUYHNTUGFR-UHFFFAOYSA-M |
| XLogP | -3.38 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.15 |
| LogP ≤ 5 | -3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-hydroxy-1,1-dimethylpiperidin-1-ium-3-carboxylate iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-hydroxy-1,1-dimethylpiperidin-1-ium-3-carboxylate iodide?
The IUPAC name of methyl 4-hydroxy-1,1-dimethylpiperidin-1-ium-3-carboxylate iodide (CID 3070302) is methyl 4-hydroxy-1,1-dimethylpiperidin-1-ium-3-carboxylate iodide.
What is the SMILES notation for methyl 4-hydroxy-1,1-dimethylpiperidin-1-ium-3-carboxylate iodide?
The canonical SMILES for methyl 4-hydroxy-1,1-dimethylpiperidin-1-ium-3-carboxylate iodide is COC(=O)C1C[N+](C)(C)CCC1O.[I-].
What is the InChIKey of methyl 4-hydroxy-1,1-dimethylpiperidin-1-ium-3-carboxylate iodide?
The InChIKey is MFURBUYHNTUGFR-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H18NO3.HI/c1-10(2)5-4-8(11)7(6-10)9(12)13-3;/h7-8,11H,4-6H2,1-3H3;1H/q+1;/p-1.
What are the key properties of methyl 4-hydroxy-1,1-dimethylpiperidin-1-ium-3-carboxylate iodide?
methyl 4-hydroxy-1,1-dimethylpiperidin-1-ium-3-carboxylate iodide has a molecular weight of 315.15 g/mol, XLogP of -3.38, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-hydroxy-1,1-dimethylpiperidin-1-ium-3-carboxylate iodide is sourced from PubChem (CID 3070302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).