C12H23N3OS — CID 3070458
Hydantoin, 5-sec-butyl-3-(3-(dimethylamino)propyl)-2-thio- (PubChem CID 3070458) has the molecular formula C12H23N3OS and a molecular weight of 257.40 g/mol. Its IUPAC name is (5R)-5-[(2R)-butan-2-yl]-3-[3-(dimethylamino)propyl]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | Hydantoin, 5-sec-butyl-3-(3-(dimethylamino)propyl)-2-thio- |
|---|---|
| PubChem CID | 3070458 |
| Molecular Formula | C12H23N3OS |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | (5R)-5-[(2R)-butan-2-yl]-3-[3-(dimethylamino)propyl]-2-sulfanylideneimidazolidin-4-one |
| SMILES | CC[C@@H](C)[C@@H]1C(=O)N(C(=S)N1)CCCN(C)C |
| InChI | InChI=1S/C12H23N3OS/c1-5-9(2)10-11(16)15(12(17)13-10)8-6-7-14(3)4/h9-10H,5-8H2,1-4H3,(H,13,17)/t9-,10-/m1/s1 |
| InChIKey | WISIUVFMEVODAQ-NXEZZACHSA-N |
| XLogP | 1.90 |
| TPSA | 67.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | 293 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|