C29H33ClN4OS — CID 3070668
2-[3-[[4-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazin-1-yl]iminomethyl]phenoxy]-N,N-dimethylethanamine (PubChem CID 3070668) has the molecular formula C29H33ClN4OS and a molecular weight of 521.13 g/mol. Its IUPAC name is 2-[3-[[4-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazin-1-yl]iminomethyl]phenoxy]-N,N-dimethylethanamine.
| Compound Name | 2-[3-[[4-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazin-1-yl]iminomethyl]phenoxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 3070668 |
| Molecular Formula | C29H33ClN4OS |
| Molecular Weight | 521.13 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | 2-[3-[[4-(3-chloro-5,6-dihydrobenzo[b][1]benzothiepin-5-yl)piperazin-1-yl]iminomethyl]phenoxy]-N,N-dimethylethanamine |
| SMILES | CN(C)CCOc1cccc(C=NN2CCN(C3Cc4ccccc4Sc4ccc(Cl)cc43)CC2)c1 |
| InChI | InChI=1S/C29H33ClN4OS/c1-32(2)16-17-35-25-8-5-6-22(18-25)21-31-34-14-12-33(13-15-34)27-19-23-7-3-4-9-28(23)36-29-11-10-24(30)20-26(27)29/h3-11,18,20-21,27H,12-17,19H2,1-2H3 |
| InChIKey | JRWQSZYMLRVPHY-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 31.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.13 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|