C24H24N2O3S2 — CID 30706826
N-(6-ethoxy-1,3-benzothiazol-2-yl)-N-(furan-2-ylmethyl)-4-phenylsulfanylbutanamide (PubChem CID 30706826) has the molecular formula C24H24N2O3S2 and a molecular weight of 452.60 g/mol. Its IUPAC name is N-(6-ethoxy-1,3-benzothiazol-2-yl)-N-(furan-2-ylmethyl)-4-phenylsulfanylbutanamide.
| Compound Name | N-(6-ethoxy-1,3-benzothiazol-2-yl)-N-(furan-2-ylmethyl)-4-phenylsulfanylbutanamide |
|---|---|
| PubChem CID | 30706826 |
| Molecular Formula | C24H24N2O3S2 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | N-(6-ethoxy-1,3-benzothiazol-2-yl)-N-(furan-2-ylmethyl)-4-phenylsulfanylbutanamide |
| SMILES | CCOc1ccc2nc(N(Cc3ccco3)C(=O)CCCSc3ccccc3)sc2c1 |
| InChI | InChI=1S/C24H24N2O3S2/c1-2-28-18-12-13-21-22(16-18)31-24(25-21)26(17-19-8-6-14-29-19)23(27)11-7-15-30-20-9-4-3-5-10-20/h3-6,8-10,12-14,16H,2,7,11,15,17H2,1H3 |
| InChIKey | SLPLGZKVROAURQ-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|