C20H17N2OS+ — CID 3070922
3-methoxy-5-methyl-2,7-diphenyl-[1,3]thiazolo[3,2-a]pyrimidin-4-ium (PubChem CID 3070922) has the molecular formula C20H17N2OS+ and a molecular weight of 333.44 g/mol. Its IUPAC name is 3-methoxy-5-methyl-2,7-diphenyl-[1,3]thiazolo[3,2-a]pyrimidin-4-ium.
| Compound Name | 3-methoxy-5-methyl-2,7-diphenyl-[1,3]thiazolo[3,2-a]pyrimidin-4-ium |
|---|---|
| PubChem CID | 3070922 |
| Molecular Formula | C20H17N2OS+ |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 3-methoxy-5-methyl-2,7-diphenyl-[1,3]thiazolo[3,2-a]pyrimidin-4-ium |
| SMILES | COc1c(-c2ccccc2)sc2nc(-c3ccccc3)cc(C)[n+]12 |
| InChI | InChI=1S/C20H17N2OS/c1-14-13-17(15-9-5-3-6-10-15)21-20-22(14)19(23-2)18(24-20)16-11-7-4-8-12-16/h3-13H,1-2H3/q+1 |
| InChIKey | RSHVFYDENUOKKI-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 26.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|