C19H19N5S — CID 3070978
3-(4-methylpiperazin-1-yl)-13-thia-2,4,5-triazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),3,5,7,9,11,14,16-octaene (PubChem CID 3070978) has the molecular formula C19H19N5S and a molecular weight of 349.46 g/mol. Its IUPAC name is 3-(4-methylpiperazin-1-yl)-13-thia-2,4,5-triazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),3,5,7,9,11,14,16-octaene.
| Compound Name | 3-(4-methylpiperazin-1-yl)-13-thia-2,4,5-triazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),3,5,7,9,11,14,16-octaene |
|---|---|
| PubChem CID | 3070978 |
| Molecular Formula | C19H19N5S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 3-(4-methylpiperazin-1-yl)-13-thia-2,4,5-triazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),3,5,7,9,11,14,16-octaene |
| SMILES | CN1CCN(c2nnc3n2-c2ccccc2Sc2ccccc2-3)CC1 |
| InChI | InChI=1S/C19H19N5S/c1-22-10-12-23(13-11-22)19-21-20-18-14-6-2-4-8-16(14)25-17-9-5-3-7-15(17)24(18)19/h2-9H,10-13H2,1H3 |
| InChIKey | IZUGYRHDWOISDN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |