About 1-azabicyclo[2.2.2]octan-3-yl 2,2-diphenylpentanoate
1-azabicyclo[2.2.2]octan-3-yl 2,2-diphenylpentanoate (PubChem CID 3071149) has the molecular formula C24H29NO2
and a molecular weight of 363.50 g/mol. Its IUPAC name is 1-azabicyclo[2.2.2]octan-3-yl 2,2-diphenylpentanoate.
Molecular Properties
| Compound Name | 1-azabicyclo[2.2.2]octan-3-yl 2,2-diphenylpentanoate |
| PubChem CID | 3071149 |
| Molecular Formula | C24H29NO2 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | 1-azabicyclo[2.2.2]octan-3-yl 2,2-diphenylpentanoate |
| SMILES | CCCC(C(=O)OC1CN2CCC1CC2)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H29NO2/c1-2-15-24(20-9-5-3-6-10-20,21-11-7-4-8-12-21)23(26)27-22-18-25-16-13-19(22)14-17-25/h3-12,19,22H,2,13-18H2,1H3 |
| InChIKey | VFFFDVTXOZYRIT-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-azabicyclo[2.2.2]octan-3-yl 2,2-diphenylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azabicyclo[2.2.2]octan-3-yl 2,2-diphenylpentanoate?
The IUPAC name of 1-azabicyclo[2.2.2]octan-3-yl 2,2-diphenylpentanoate (CID 3071149) is 1-azabicyclo[2.2.2]octan-3-yl 2,2-diphenylpentanoate.
What is the SMILES notation for 1-azabicyclo[2.2.2]octan-3-yl 2,2-diphenylpentanoate?
The canonical SMILES for 1-azabicyclo[2.2.2]octan-3-yl 2,2-diphenylpentanoate is CCCC(C(=O)OC1CN2CCC1CC2)(c1ccccc1)c1ccccc1.
What is the InChIKey of 1-azabicyclo[2.2.2]octan-3-yl 2,2-diphenylpentanoate?
The InChIKey is VFFFDVTXOZYRIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H29NO2/c1-2-15-24(20-9-5-3-6-10-20,21-11-7-4-8-12-21)23(26)27-22-18-25-16-13-19(22)14-17-25/h3-12,19,22H,2,13-18H2,1H3.
What are the key properties of 1-azabicyclo[2.2.2]octan-3-yl 2,2-diphenylpentanoate?
1-azabicyclo[2.2.2]octan-3-yl 2,2-diphenylpentanoate has a molecular weight of 363.50 g/mol, XLogP of 4.41, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azabicyclo[2.2.2]octan-3-yl 2,2-diphenylpentanoate is sourced from PubChem (CID 3071149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).