About 4-(3-phenyl-[1,2,4]triazolo[3,4-a]phthalazin-6-yl)morpholine
4-(3-phenyl-[1,2,4]triazolo[3,4-a]phthalazin-6-yl)morpholine (PubChem CID 3071186) has the molecular formula C19H17N5O
and a molecular weight of 331.38 g/mol. Its IUPAC name is 4-(3-phenyl-[1,2,4]triazolo[3,4-a]phthalazin-6-yl)morpholine.
Molecular Properties
| Compound Name | 4-(3-phenyl-[1,2,4]triazolo[3,4-a]phthalazin-6-yl)morpholine |
| PubChem CID | 3071186 |
| Molecular Formula | C19H17N5O |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 4-(3-phenyl-[1,2,4]triazolo[3,4-a]phthalazin-6-yl)morpholine |
| SMILES | c1ccc(-c2nnc3c4ccccc4c(N4CCOCC4)nn23)cc1 |
| InChI | InChI=1S/C19H17N5O/c1-2-6-14(7-3-1)17-20-21-18-15-8-4-5-9-16(15)19(22-24(17)18)23-10-12-25-13-11-23/h1-9H,10-13H2 |
| InChIKey | FFXVMDJRDNDICF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 55.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(3-phenyl-[1,2,4]triazolo[3,4-a]phthalazin-6-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-phenyl-[1,2,4]triazolo[3,4-a]phthalazin-6-yl)morpholine?
The IUPAC name of 4-(3-phenyl-[1,2,4]triazolo[3,4-a]phthalazin-6-yl)morpholine (CID 3071186) is 4-(3-phenyl-[1,2,4]triazolo[3,4-a]phthalazin-6-yl)morpholine.
What is the SMILES notation for 4-(3-phenyl-[1,2,4]triazolo[3,4-a]phthalazin-6-yl)morpholine?
The canonical SMILES for 4-(3-phenyl-[1,2,4]triazolo[3,4-a]phthalazin-6-yl)morpholine is c1ccc(-c2nnc3c4ccccc4c(N4CCOCC4)nn23)cc1.
What is the InChIKey of 4-(3-phenyl-[1,2,4]triazolo[3,4-a]phthalazin-6-yl)morpholine?
The InChIKey is FFXVMDJRDNDICF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N5O/c1-2-6-14(7-3-1)17-20-21-18-15-8-4-5-9-16(15)19(22-24(17)18)23-10-12-25-13-11-23/h1-9H,10-13H2.
What are the key properties of 4-(3-phenyl-[1,2,4]triazolo[3,4-a]phthalazin-6-yl)morpholine?
4-(3-phenyl-[1,2,4]triazolo[3,4-a]phthalazin-6-yl)morpholine has a molecular weight of 331.38 g/mol, XLogP of 2.78, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-phenyl-[1,2,4]triazolo[3,4-a]phthalazin-6-yl)morpholine is sourced from PubChem (CID 3071186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).