C16H13N5 — CID 3071189
N-methyl-3-phenyl-[1,2,4]triazolo[3,4-a]phthalazin-6-amine (PubChem CID 3071189) has the molecular formula C16H13N5 and a molecular weight of 275.31 g/mol. Its IUPAC name is N-methyl-3-phenyl-[1,2,4]triazolo[3,4-a]phthalazin-6-amine.
| Compound Name | N-methyl-3-phenyl-[1,2,4]triazolo[3,4-a]phthalazin-6-amine |
|---|---|
| PubChem CID | 3071189 |
| Molecular Formula | C16H13N5 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | N-methyl-3-phenyl-[1,2,4]triazolo[3,4-a]phthalazin-6-amine |
| SMILES | CNc1nn2c(-c3ccccc3)nnc2c2ccccc12 |
| InChI | InChI=1S/C16H13N5/c1-17-14-12-9-5-6-10-13(12)16-19-18-15(21(16)20-14)11-7-3-2-4-8-11/h2-10H,1H3,(H,17,20) |
| InChIKey | GLRABDXTKZYASM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |