C19H19N5 — CID 3071195
N,N-diethyl-3-phenyl-[1,2,4]triazolo[3,4-a]phthalazin-6-amine (PubChem CID 3071195) has the molecular formula C19H19N5 and a molecular weight of 317.40 g/mol. Its IUPAC name is N,N-diethyl-3-phenyl-[1,2,4]triazolo[3,4-a]phthalazin-6-amine.
| Compound Name | N,N-diethyl-3-phenyl-[1,2,4]triazolo[3,4-a]phthalazin-6-amine |
|---|---|
| PubChem CID | 3071195 |
| Molecular Formula | C19H19N5 |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | N,N-diethyl-3-phenyl-[1,2,4]triazolo[3,4-a]phthalazin-6-amine |
| SMILES | CCN(CC)c1nn2c(-c3ccccc3)nnc2c2ccccc12 |
| InChI | InChI=1S/C19H19N5/c1-3-23(4-2)19-16-13-9-8-12-15(16)18-21-20-17(24(18)22-19)14-10-6-5-7-11-14/h5-13H,3-4H2,1-2H3 |
| InChIKey | MYVVUIHTMICTCX-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |