C20H19N5 — CID 3071196
3-phenyl-6-piperidin-1-yl-[1,2,4]triazolo[3,4-a]phthalazine (PubChem CID 3071196) has the molecular formula C20H19N5 and a molecular weight of 329.41 g/mol. Its IUPAC name is 3-phenyl-6-piperidin-1-yl-[1,2,4]triazolo[3,4-a]phthalazine.
| Compound Name | 3-phenyl-6-piperidin-1-yl-[1,2,4]triazolo[3,4-a]phthalazine |
|---|---|
| PubChem CID | 3071196 |
| Molecular Formula | C20H19N5 |
| Molecular Weight | 329.41 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 3-phenyl-6-piperidin-1-yl-[1,2,4]triazolo[3,4-a]phthalazine |
| SMILES | c1ccc(-c2nnc3c4ccccc4c(N4CCCCC4)nn23)cc1 |
| InChI | InChI=1S/C20H19N5/c1-3-9-15(10-4-1)18-21-22-19-16-11-5-6-12-17(16)20(23-25(18)19)24-13-7-2-8-14-24/h1,3-6,9-12H,2,7-8,13-14H2 |
| InChIKey | YRSBUBOHVMZWGF-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.41 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |