C20H14ClIN2O2S — CID 30712434
N-(5-chloro-4-methyl-1,3-benzothiazol-2-yl)-N-(furan-2-ylmethyl)-2-iodobenzamide (PubChem CID 30712434) has the molecular formula C20H14ClIN2O2S and a molecular weight of 508.77 g/mol. Its IUPAC name is N-(5-chloro-4-methyl-1,3-benzothiazol-2-yl)-N-(furan-2-ylmethyl)-2-iodobenzamide.
| Compound Name | N-(5-chloro-4-methyl-1,3-benzothiazol-2-yl)-N-(furan-2-ylmethyl)-2-iodobenzamide |
|---|---|
| PubChem CID | 30712434 |
| Molecular Formula | C20H14ClIN2O2S |
| Molecular Weight | 508.77 g/mol |
| Exact Mass | 507.95 |
| IUPAC Name | N-(5-chloro-4-methyl-1,3-benzothiazol-2-yl)-N-(furan-2-ylmethyl)-2-iodobenzamide |
| SMILES | Cc1c(Cl)ccc2sc(N(Cc3ccco3)C(=O)c3ccccc3I)nc12 |
| InChI | InChI=1S/C20H14ClIN2O2S/c1-12-15(21)8-9-17-18(12)23-20(27-17)24(11-13-5-4-10-26-13)19(25)14-6-2-3-7-16(14)22/h2-10H,11H2,1H3 |
| InChIKey | YSYHZQGSWWLMEQ-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.77 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|