C18H20N2O4S — CID 30713117
N-(4-tert-butylphenyl)-3-methyl-2-oxo-1,3-benzoxazole-6-sulfonamide (PubChem CID 30713117) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-3-methyl-2-oxo-1,3-benzoxazole-6-sulfonamide.
| Compound Name | N-(4-tert-butylphenyl)-3-methyl-2-oxo-1,3-benzoxazole-6-sulfonamide |
|---|---|
| PubChem CID | 30713117 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | N-(4-tert-butylphenyl)-3-methyl-2-oxo-1,3-benzoxazole-6-sulfonamide |
| SMILES | Cn1c(=O)oc2cc(S(=O)(=O)Nc3ccc(C(C)(C)C)cc3)ccc21 |
| InChI | InChI=1S/C18H20N2O4S/c1-18(2,3)12-5-7-13(8-6-12)19-25(22,23)14-9-10-15-16(11-14)24-17(21)20(15)4/h5-11,19H,1-4H3 |
| InChIKey | NHHUXRNTHMXYFE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |