C24H31N7O — CID 3071367
6-[4-(1-benzofuran-2-ylmethyl)piperazin-1-yl]-2-N,4-N-bis(but-2-enyl)-1,3,5-triazine-2,4-diamine (PubChem CID 3071367) has the molecular formula C24H31N7O and a molecular weight of 433.56 g/mol. Its IUPAC name is 6-[4-(1-benzofuran-2-ylmethyl)piperazin-1-yl]-2-N,4-N-bis(but-2-enyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[4-(1-benzofuran-2-ylmethyl)piperazin-1-yl]-2-N,4-N-bis(but-2-enyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 3071367 |
| Molecular Formula | C24H31N7O |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | 6-[4-(1-benzofuran-2-ylmethyl)piperazin-1-yl]-2-N,4-N-bis(but-2-enyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CC=CCNc1nc(NCC=CC)nc(N2CCN(Cc3cc4ccccc4o3)CC2)n1 |
| InChI | InChI=1S/C24H31N7O/c1-3-5-11-25-22-27-23(26-12-6-4-2)29-24(28-22)31-15-13-30(14-16-31)18-20-17-19-9-7-8-10-21(19)32-20/h3-10,17H,11-16,18H2,1-2H3,(H2,25,26,27,28,29) |
| InChIKey | MYSRMFBLSTVQJP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|