C24H30N6O — CID 3071370
6-[4-(2H-chromen-3-ylmethyl)piperazin-1-yl]-2-N,4-N-bis(prop-2-enyl)pyrimidine-2,4-diamine (PubChem CID 3071370) has the molecular formula C24H30N6O and a molecular weight of 418.55 g/mol. Its IUPAC name is 6-[4-(2H-chromen-3-ylmethyl)piperazin-1-yl]-2-N,4-N-bis(prop-2-enyl)pyrimidine-2,4-diamine.
| Compound Name | 6-[4-(2H-chromen-3-ylmethyl)piperazin-1-yl]-2-N,4-N-bis(prop-2-enyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 3071370 |
| Molecular Formula | C24H30N6O |
| Molecular Weight | 418.55 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | 6-[4-(2H-chromen-3-ylmethyl)piperazin-1-yl]-2-N,4-N-bis(prop-2-enyl)pyrimidine-2,4-diamine |
| SMILES | C=CCNc1cc(N2CCN(CC3=Cc4ccccc4OC3)CC2)nc(NCC=C)n1 |
| InChI | InChI=1S/C24H30N6O/c1-3-9-25-22-16-23(28-24(27-22)26-10-4-2)30-13-11-29(12-14-30)17-19-15-20-7-5-6-8-21(20)31-18-19/h3-8,15-16H,1-2,9-14,17-18H2,(H2,25,26,27,28) |
| InChIKey | FGOLCJLHGVXEJQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.55 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|