About 5-[(6-methoxy-2,3-dihydro-1H-inden-1-yl)methyl]-2H-tetrazole
5-[(6-methoxy-2,3-dihydro-1H-inden-1-yl)methyl]-2H-tetrazole (PubChem CID 3071402) has the molecular formula C12H14N4O
and a molecular weight of 230.27 g/mol. Its IUPAC name is 5-[(6-methoxy-2,3-dihydro-1H-inden-1-yl)methyl]-2H-tetrazole.
Molecular Properties
| Compound Name | 5-[(6-methoxy-2,3-dihydro-1H-inden-1-yl)methyl]-2H-tetrazole |
| PubChem CID | 3071402 |
| Molecular Formula | C12H14N4O |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 5-[(6-methoxy-2,3-dihydro-1H-inden-1-yl)methyl]-2H-tetrazole |
| SMILES | COc1ccc2c(c1)C(Cc1nn[nH]n1)CC2 |
| InChI | InChI=1S/C12H14N4O/c1-17-10-5-4-8-2-3-9(11(8)7-10)6-12-13-15-16-14-12/h4-5,7,9H,2-3,6H2,1H3,(H,13,14,15,16) |
| InChIKey | LRRTVCHHCMDINI-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(6-methoxy-2,3-dihydro-1H-inden-1-yl)methyl]-2H-tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(6-methoxy-2,3-dihydro-1H-inden-1-yl)methyl]-2H-tetrazole?
The IUPAC name of 5-[(6-methoxy-2,3-dihydro-1H-inden-1-yl)methyl]-2H-tetrazole (CID 3071402) is 5-[(6-methoxy-2,3-dihydro-1H-inden-1-yl)methyl]-2H-tetrazole.
What is the SMILES notation for 5-[(6-methoxy-2,3-dihydro-1H-inden-1-yl)methyl]-2H-tetrazole?
The canonical SMILES for 5-[(6-methoxy-2,3-dihydro-1H-inden-1-yl)methyl]-2H-tetrazole is COc1ccc2c(c1)C(Cc1nn[nH]n1)CC2.
What is the InChIKey of 5-[(6-methoxy-2,3-dihydro-1H-inden-1-yl)methyl]-2H-tetrazole?
The InChIKey is LRRTVCHHCMDINI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4O/c1-17-10-5-4-8-2-3-9(11(8)7-10)6-12-13-15-16-14-12/h4-5,7,9H,2-3,6H2,1H3,(H,13,14,15,16).
What are the key properties of 5-[(6-methoxy-2,3-dihydro-1H-inden-1-yl)methyl]-2H-tetrazole?
5-[(6-methoxy-2,3-dihydro-1H-inden-1-yl)methyl]-2H-tetrazole has a molecular weight of 230.27 g/mol, XLogP of 1.48, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(6-methoxy-2,3-dihydro-1H-inden-1-yl)methyl]-2H-tetrazole is sourced from PubChem (CID 3071402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).