C12H23IN4O3S — CID 3071468
1-methyl-N-[3-(4-methylmorpholin-4-ium-4-yl)propyl]imidazole-4-sulfonamide iodide (PubChem CID 3071468) has the molecular formula C12H23IN4O3S and a molecular weight of 430.31 g/mol. Its IUPAC name is 1-methyl-N-[3-(4-methylmorpholin-4-ium-4-yl)propyl]imidazole-4-sulfonamide iodide.
| Compound Name | 1-methyl-N-[3-(4-methylmorpholin-4-ium-4-yl)propyl]imidazole-4-sulfonamide iodide |
|---|---|
| PubChem CID | 3071468 |
| Molecular Formula | C12H23IN4O3S |
| Molecular Weight | 430.31 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | 1-methyl-N-[3-(4-methylmorpholin-4-ium-4-yl)propyl]imidazole-4-sulfonamide iodide |
| SMILES | Cn1cnc(S(=O)(=O)NCCC[N+]2(C)CCOCC2)c1.[I-] |
| InChI | InChI=1S/C12H23N4O3S.HI/c1-15-10-12(13-11-15)20(17,18)14-4-3-5-16(2)6-8-19-9-7-16;/h10-11,14H,3-9H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | YERJFTNELPGNAK-UHFFFAOYSA-M |
| XLogP | -3.43 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.31 |
| LogP ≤ 5 | -3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|