About 2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]acetonitrile
2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]acetonitrile (PubChem CID 3071534) has the molecular formula C5H2Cl2N4O
and a molecular weight of 205.00 g/mol. Its IUPAC name is 2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]acetonitrile.
Molecular Properties
| Compound Name | 2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]acetonitrile |
| PubChem CID | 3071534 |
| Molecular Formula | C5H2Cl2N4O |
| Molecular Weight | 205.00 g/mol |
| Exact Mass | 203.96 |
| IUPAC Name | 2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]acetonitrile |
| SMILES | N#CCOc1nc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C5H2Cl2N4O/c6-3-9-4(7)11-5(10-3)12-2-1-8/h2H2 |
| InChIKey | MVBQCLXLDCCHDI-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 71.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.00 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]acetonitrile?
The IUPAC name of 2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]acetonitrile (CID 3071534) is 2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]acetonitrile.
What is the SMILES notation for 2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]acetonitrile?
The canonical SMILES for 2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]acetonitrile is N#CCOc1nc(Cl)nc(Cl)n1.
What is the InChIKey of 2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]acetonitrile?
The InChIKey is MVBQCLXLDCCHDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H2Cl2N4O/c6-3-9-4(7)11-5(10-3)12-2-1-8/h2H2.
What are the key properties of 2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]acetonitrile?
2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]acetonitrile has a molecular weight of 205.00 g/mol, XLogP of 1.08, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4,6-dichloro-1,3,5-triazin-2-yl)oxy]acetonitrile is sourced from PubChem (CID 3071534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).