C6H3N5O2 — CID 3071537
2-(4,6-dioxo-1,3,5-triazinan-2-ylidene)propanedinitrile (PubChem CID 3071537) has the molecular formula C6H3N5O2 and a molecular weight of 177.12 g/mol. Its IUPAC name is 2-(4,6-dioxo-1,3,5-triazinan-2-ylidene)propanedinitrile.
| Compound Name | 2-(4,6-dioxo-1,3,5-triazinan-2-ylidene)propanedinitrile |
|---|---|
| PubChem CID | 3071537 |
| Molecular Formula | C6H3N5O2 |
| Molecular Weight | 177.12 g/mol |
| Exact Mass | 177.03 |
| IUPAC Name | 2-(4,6-dioxo-1,3,5-triazinan-2-ylidene)propanedinitrile |
| SMILES | N#CC(C#N)=C1NC(=O)NC(=O)N1 |
| InChI | InChI=1S/C6H3N5O2/c7-1-3(2-8)4-9-5(12)11-6(13)10-4/h(H3,9,10,11,12,13) |
| InChIKey | FRBLSBQVVBMGHD-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 117.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.12 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|