C14H30Cl2N2O2 — CID 3071580
(1S,2S,3R,6R)-3,6-bis(diethylamino)cyclohex-4-ene-1,2-diol;dihydrochloride (PubChem CID 3071580) has the molecular formula C14H30Cl2N2O2 and a molecular weight of 329.31 g/mol. Its IUPAC name is (1S,2S,3R,6R)-3,6-bis(diethylamino)cyclohex-4-ene-1,2-diol;dihydrochloride.
| Compound Name | (1S,2S,3R,6R)-3,6-bis(diethylamino)cyclohex-4-ene-1,2-diol;dihydrochloride |
|---|---|
| PubChem CID | 3071580 |
| Molecular Formula | C14H30Cl2N2O2 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (1S,2S,3R,6R)-3,6-bis(diethylamino)cyclohex-4-ene-1,2-diol;dihydrochloride |
| SMILES | CCN(CC)[C@@H]1C=C[C@@H](N(CC)CC)[C@H](O)[C@H]1O.Cl.Cl |
| InChI | InChI=1S/C14H28N2O2.2ClH/c1-5-15(6-2)11-9-10-12(14(18)13(11)17)16(7-3)8-4;;/h9-14,17-18H,5-8H2,1-4H3;2*1H/t11-,12-,13+,14+;;/m1../s1 |
| InChIKey | YVKSMWJOZJZYEO-PYOUUUKNSA-N |
| XLogP | 1.54 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|