C16H30I2N2O4 — CID 3071590
[(1R,6S)-5,6-diacetyloxy-4-(trimethylazaniumyl)cyclohex-2-en-1-yl]-trimethylazanium diiodide (PubChem CID 3071590) has the molecular formula C16H30I2N2O4 and a molecular weight of 568.23 g/mol. Its IUPAC name is [(1R,6S)-5,6-diacetyloxy-4-(trimethylazaniumyl)cyclohex-2-en-1-yl]-trimethylazanium diiodide.
| Compound Name | [(1R,6S)-5,6-diacetyloxy-4-(trimethylazaniumyl)cyclohex-2-en-1-yl]-trimethylazanium diiodide |
|---|---|
| PubChem CID | 3071590 |
| Molecular Formula | C16H30I2N2O4 |
| Molecular Weight | 568.23 g/mol |
| Exact Mass | 568.03 |
| IUPAC Name | [(1R,6S)-5,6-diacetyloxy-4-(trimethylazaniumyl)cyclohex-2-en-1-yl]-trimethylazanium diiodide |
| SMILES | CC(=O)OC1C([N+](C)(C)C)C=C[C@@H]([N+](C)(C)C)[C@@H]1OC(C)=O.[I-].[I-] |
| InChI | InChI=1S/C16H30N2O4.2HI/c1-11(19)21-15-13(17(3,4)5)9-10-14(18(6,7)8)16(15)22-12(2)20;;/h9-10,13-16H,1-8H3;2*1H/q+2;;/p-2/t13-,14?,15+,16?;;/m1../s1 |
| InChIKey | CSTGETGXIYKDEQ-HSXRZVTJSA-L |
| XLogP | -5.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.23 |
| LogP ≤ 5 | -5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|